cas: 1374666-32-6 — see every product listed under this CAS number, including other names
Mal-PEG2-acid, 99.90% (CAS 1374666-32-6) is a chemical reagent available from Chemat. Available pack sizes: 1 g, 25 g, 10 g, 5 g, 100 mg, 250 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-130442-1 g |
| cas | 1374666-32-6 |
| size | 1 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 1 g | 937.34 Pln | |
| MedChemExpress | 25 g | 9115.43 Pln | |
| MedChemExpress | 10 g | 4629.32 Pln | |
| MedChemExpress | 5 g | 2878.54 Pln | |
| MedChemExpress | 100 mg | 384.71 Pln | |
| MedChemExpress | 250 mg | 505.45 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.90% |
3-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]propanoic acid (CAS 1374666-32-6) is a chemical compound with the molecular formula C11H15NO6 and a molecular weight of 257.24 g/mol. IUPAC name: 3-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]propanoic acid. InChIKey: TXMDOUPVKVGPIS-UHFFFAOYSA-N.
| Molecular formula | C11H15NO6 |
|---|---|
| Molecular weight | 257.24 g/mol |
| IUPAC name | 3-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]propanoic acid |
| InChIKey | TXMDOUPVKVGPIS-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CCOCCOCCC(=O)O |
Computed by PubChem (NCBI)