CAS 202057-76-9 appears in our catalog under these names: Manitimus/ 99.75% (existing batch purity), Manitimus (FK778), Manitimus, Manitimus, 98.54%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 20mg, 5mg, 1 mg, 20 mg, 10mM/1mL, 5 mg.
(Z)-2-cyano-3-hydroxy-N-[4-(trifluoromethyl)phenyl]hept-2-en-6-ynamide (CAS 202057-76-9) is a chemical compound with the molecular formula C15H11F3N2O2 and a molecular weight of 308.25 g/mol. IUPAC name: (Z)-2-cyano-3-hydroxy-N-[4-(trifluoromethyl)phenyl]hept-2-en-6-ynamide. InChIKey: IRELROQHIPLASX-SEYXRHQNSA-N.
| Molecular formula | C15H11F3N2O2 |
|---|---|
| Molecular weight | 308.25 g/mol |
| IUPAC name | (Z)-2-cyano-3-hydroxy-N-[4-(trifluoromethyl)phenyl]hept-2-en-6-ynamide |
| InChIKey | IRELROQHIPLASX-SEYXRHQNSA-N |
| SMILES | C#CCC/C(=C(\C#N)/C(=O)NC1=CC=C(C=C1)C(F)(F)F)/O |
Computed by PubChem (NCBI)