CAS 120503-45-9 appears in our catalog under these names: Metacavir/ 99.36% (existing batch purity), Metacavir. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 5 mg, 1 mg.
[(2S,5R)-5-(2-amino-6-methoxypurin-9-yl)oxolan-2-yl]methanol (CAS 120503-45-9) is a chemical compound with the molecular formula C11H15N5O3 and a molecular weight of 265.27 g/mol. IUPAC name: [(2S,5R)-5-(2-amino-6-methoxypurin-9-yl)oxolan-2-yl]methanol. InChIKey: FJAOCNGVPLTSLD-NKWVEPMBSA-N.
| Molecular formula | C11H15N5O3 |
|---|---|
| Molecular weight | 265.27 g/mol |
| IUPAC name | [(2S,5R)-5-(2-amino-6-methoxypurin-9-yl)oxolan-2-yl]methanol |
| InChIKey | FJAOCNGVPLTSLD-NKWVEPMBSA-N |
| SMILES | COC1=NC(=NC2=C1N=CN2[C@H]3CC[C@H](O3)CO)N |
Computed by PubChem (NCBI)