Products 65162-13-2
CAS 65162-13-2 appears in our catalog under these names: Methoxy-PMS/ 99.33% (existing batch purity), Methoxy–PMS (1–Methoxy PMS), 1-Methoxy-5-methylphenazinium methyl sulfate, 95.00%, 1-Methoxy-5-methylphenazinium Methyl Sulfate [for Biochemical Research], >95.0%(HPLC), Methoxy-PMS 96%. Offered by: TargetMol, GLPBio, Chemat, TCI, Ambeed. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 200mg, 500mg, 5g.
1-methoxy-5-methylphenazin-5-ium;methyl sulfate (CAS 65162-13-2) is a chemical compound with the molecular formula C15H16N2O5S and a molecular weight of 336.4 g/mol. IUPAC name: 1-methoxy-5-methylphenazin-5-ium;methyl sulfate. InChIKey: MASUWVVNWALEEM-UHFFFAOYSA-M.
| Molecular formula | C15H16N2O5S |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | 1-methoxy-5-methylphenazin-5-ium;methyl sulfate |
| InChIKey | MASUWVVNWALEEM-UHFFFAOYSA-M |
| SMILES | C[N+]1=C2C=CC=C(C2=NC3=CC=CC=C31)OC.COS(=O)(=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
1-Methoxy-5-methylphenazinium methyl sulfate, 1-Methoxyphenazine methosulfate, Phenazinium, 1-methoxy-5-methyl-, methyl sulfate, 1-methoxy-5-methylphenazonium methosulfate, MMPMS, Methoxy-PMS, 1-Methoxy PMS, 1-methoxy-5-methylphenazin-5-ium methyl sulfate, 1-methoxy-5-methylphenazinium methylsulfate, 1-methoxy-5-methylphenazin-5-ium;methyl sulfate