cas: 913742-54-8 — see every product listed under this CAS number, including other names
Methyl (2S,4R)-4-Boc-aminopyrrolidine-2-carboxylate hydrochloride 95% (CAS 913742-54-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A176637-100mg |
| cas | 913742-54-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 464.94 Pln | |
| Ambeed | 250mg | 731.94 Pln | |
| Ambeed | 1g | 1799.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A176637 |
Methyl (2S,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidine-2-carboxylate;hydrochloride (CAS 913742-54-8) is a chemical compound with the molecular formula C11H21ClN2O4 and a molecular weight of 280.75 g/mol. IUPAC name: methyl (2S,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidine-2-carboxylate;hydrochloride. InChIKey: KJYYJRIAHJXTNC-WLYNEOFISA-N.
| Molecular formula | C11H21ClN2O4 |
|---|---|
| Molecular weight | 280.75 g/mol |
| IUPAC name | methyl (2S,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidine-2-carboxylate;hydrochloride |
| InChIKey | KJYYJRIAHJXTNC-WLYNEOFISA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C[C@H](NC1)C(=O)OC.Cl |
Computed by PubChem (NCBI)