CAS 1251903-83-9 appears in our catalog under these names: (R)-4-N-Boc-piperazine-2-carboxylic acid methyl ester hydrochloride, 95%, (R)–1–tert–Butyl 3–methyl piperazine–1,3–dicarboxylate hydrochloride, (R)-4-N-Boc-piperazine-2-carboxylic acid methyl ester-hcl, ≥95%, ≥95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 10g, 1g, 5g, 100mg, 250mg.
1-O-tert-butyl 3-O-methyl (3R)-piperazine-1,3-dicarboxylate;hydrochloride (CAS 1251903-83-9) is a chemical compound with the molecular formula C11H21ClN2O4 and a molecular weight of 280.75 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl (3R)-piperazine-1,3-dicarboxylate;hydrochloride. InChIKey: MEZKKNPBRVNHQT-DDWIOCJRSA-N.
| Molecular formula | C11H21ClN2O4 |
|---|---|
| Molecular weight | 280.75 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl (3R)-piperazine-1,3-dicarboxylate;hydrochloride |
| InChIKey | MEZKKNPBRVNHQT-DDWIOCJRSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN[C@H](C1)C(=O)OC.Cl |
Computed by PubChem (NCBI)