CAS 1217702-80-1 appears in our catalog under these names: (S)-1-tert-Butyl 3-methyl piperazine-1,3-dicarboxylate hydrochloride, 95%, (S)–1–tert–Butyl 3–methyl piperazine–1,3–dicarboxylate hydrochloride, (S)-1-tert-Butyl 3-methyl piperazine-1,3-dicarboxylate hydrochloride, 95%, 95%, 1-(TERT-BUTYL) 3-METHYL (S)-PIPERAZINE-1,3-DICARBOXYLATE HYDROCHLORIDE, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g.
1-O-tert-butyl 3-O-methyl (3S)-piperazine-1,3-dicarboxylate;hydrochloride (CAS 1217702-80-1) is a chemical compound with the molecular formula C11H21ClN2O4 and a molecular weight of 280.75 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl (3S)-piperazine-1,3-dicarboxylate;hydrochloride. InChIKey: MEZKKNPBRVNHQT-QRPNPIFTSA-N.
| Molecular formula | C11H21ClN2O4 |
|---|---|
| Molecular weight | 280.75 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl (3S)-piperazine-1,3-dicarboxylate;hydrochloride |
| InChIKey | MEZKKNPBRVNHQT-QRPNPIFTSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN[C@@H](C1)C(=O)OC.Cl |
Computed by PubChem (NCBI)