CAS 1251903-93-1 appears in our catalog under these names: (S)-1-tert-Butyl 2-methyl piperazine-1,2-dicarboxylate hydrochloride, 95%, (S)–1–tert–Butyl 2–methyl piperazine–1,2–dicarboxylate hydrochloride, (S)-1-tert-Butyl 2-methyl piperazine-1,2-dicarboxylate hydrochloride, 98%, 98%, (S)-1-tert-Butyl 2-methyl piperazine-1,2-dicarboxylate hydrochloride, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
1-O-tert-butyl 2-O-methyl (2S)-piperazine-1,2-dicarboxylate;hydrochloride (CAS 1251903-93-1) is a chemical compound with the molecular formula C11H21ClN2O4 and a molecular weight of 280.75 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S)-piperazine-1,2-dicarboxylate;hydrochloride. InChIKey: MESGHYLTRXYTHM-QRPNPIFTSA-N.
| Molecular formula | C11H21ClN2O4 |
|---|---|
| Molecular weight | 280.75 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2S)-piperazine-1,2-dicarboxylate;hydrochloride |
| InChIKey | MESGHYLTRXYTHM-QRPNPIFTSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCNC[C@H]1C(=O)OC.Cl |
Computed by PubChem (NCBI)