CAS 1269449-40-2 appears in our catalog under these names: 1-N-Boc-piperazine-2-carboxylic acid methyl ester hydrochloride, 98%, 1-tert-Butyl 2-methyl piperazine-1,2-dicarboxylate hydrochloride, 95%, 1–tert–Butyl 2–methyl piperazine–1,2–dicarboxylate hydrochloride, 1-tert-Butyl 2-methyl piperazine-1,2-dicarboxylate hydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 5g, 1g, 10g, 25g.
1-O-tert-butyl 2-O-methyl piperazine-1,2-dicarboxylate;hydrochloride (CAS 1269449-40-2) is a chemical compound with the molecular formula C11H21ClN2O4 and a molecular weight of 280.75 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl piperazine-1,2-dicarboxylate;hydrochloride. InChIKey: MESGHYLTRXYTHM-UHFFFAOYSA-N.
| Molecular formula | C11H21ClN2O4 |
|---|---|
| Molecular weight | 280.75 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl piperazine-1,2-dicarboxylate;hydrochloride |
| InChIKey | MESGHYLTRXYTHM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCNCC1C(=O)OC.Cl |
Computed by PubChem (NCBI)