cas: 32345-60-1 — see every product listed under this CAS number, including other names
Methyl (S)-2-(2-chlorophenyl)-2-hydroxyacetate, 95% (CAS 32345-60-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F695236-1G |
| cas | 32345-60-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 169.75 Pln | |
| Fluorochem | 5g | 607.10 Pln | |
| Fluorochem | 25g | 2533.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Methyl (2S)-2-(2-chlorophenyl)-2-hydroxyacetate (CAS 32345-60-1) is a chemical compound with the molecular formula C9H9ClO3 and a molecular weight of 200.62 g/mol. IUPAC name: methyl (2S)-2-(2-chlorophenyl)-2-hydroxyacetate. InChIKey: ZMPGBVQQIQSQED-QMMMGPOBSA-N.
| Molecular formula | C9H9ClO3 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | methyl (2S)-2-(2-chlorophenyl)-2-hydroxyacetate |
| InChIKey | ZMPGBVQQIQSQED-QMMMGPOBSA-N |
| SMILES | COC(=O)[C@H](C1=CC=CC=C1Cl)O |
Computed by PubChem (NCBI)