cas: 27079-29-4 — see every product listed under this CAS number, including other names
Methyl [(2-aminophenyl)carbamothioyl]carbamate 97% (CAS 27079-29-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A266135-100mg |
| cas | 27079-29-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 214.62 Pln | |
| Ambeed | 250mg | 264.69 Pln | |
| Ambeed | 1g | 303.62 Pln | |
| Ambeed | 5g | 882.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A266135 |
Methyl N-[(2-aminophenyl)carbamothioyl]carbamate (CAS 27079-29-4) is a chemical compound with the molecular formula C9H11N3O2S and a molecular weight of 225.27 g/mol. IUPAC name: methyl N-[(2-aminophenyl)carbamothioyl]carbamate. InChIKey: YTGVAKDRFRGYAM-UHFFFAOYSA-N.
| Molecular formula | C9H11N3O2S |
|---|---|
| Molecular weight | 225.27 g/mol |
| IUPAC name | methyl N-[(2-aminophenyl)carbamothioyl]carbamate |
| InChIKey | YTGVAKDRFRGYAM-UHFFFAOYSA-N |
| SMILES | COC(=O)NC(=S)NC1=CC=CC=C1N |
Computed by PubChem (NCBI)