CAS 1289386-12-4 appears in our catalog under these names: 1-(2-Methylsulfanyl-pyrimidin-4-yl)-azetidine-3-carboxylic acid, 95%, 1–(2–(Methylthio)pyrimidin–4–yl)azetidine–3–carboxylic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
1-(2-methylsulfanylpyrimidin-4-yl)azetidine-3-carboxylic acid (CAS 1289386-12-4) is a chemical compound with the molecular formula C9H11N3O2S and a molecular weight of 225.27 g/mol. IUPAC name: 1-(2-methylsulfanylpyrimidin-4-yl)azetidine-3-carboxylic acid. InChIKey: DQGWZWULPMPHLN-UHFFFAOYSA-N.
| Molecular formula | C9H11N3O2S |
|---|---|
| Molecular weight | 225.27 g/mol |
| IUPAC name | 1-(2-methylsulfanylpyrimidin-4-yl)azetidine-3-carboxylic acid |
| InChIKey | DQGWZWULPMPHLN-UHFFFAOYSA-N |
| SMILES | CSC1=NC=CC(=N1)N2CC(C2)C(=O)O |
Computed by PubChem (NCBI)