CAS 349422-98-6 is the registry number for N,N-Dimethyl benzoimidazole-1-sulfonamide, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 25g.
N,N-dimethylbenzimidazole-1-sulfonamide (CAS 349422-98-6) is a chemical compound with the molecular formula C9H11N3O2S and a molecular weight of 225.27 g/mol. IUPAC name: N,N-dimethylbenzimidazole-1-sulfonamide. InChIKey: XDXIDHANDJYSQA-UHFFFAOYSA-N.
| Molecular formula | C9H11N3O2S |
|---|---|
| Molecular weight | 225.27 g/mol |
| IUPAC name | N,N-dimethylbenzimidazole-1-sulfonamide |
| InChIKey | XDXIDHANDJYSQA-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)N1C=NC2=CC=CC=C21 |
Computed by PubChem (NCBI)