CAS 1072805-54-9 is the registry number for 1-(5-Acetyl-4-methylthiazol-2-yl)imidazolidin-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-(5-acetyl-4-methyl-1,3-thiazol-2-yl)imidazolidin-2-one (CAS 1072805-54-9) is a chemical compound with the molecular formula C9H11N3O2S and a molecular weight of 225.27 g/mol. IUPAC name: 1-(5-acetyl-4-methyl-1,3-thiazol-2-yl)imidazolidin-2-one. InChIKey: IDPVLJLFBNPMCT-UHFFFAOYSA-N.
| Molecular formula | C9H11N3O2S |
|---|---|
| Molecular weight | 225.27 g/mol |
| IUPAC name | 1-(5-acetyl-4-methyl-1,3-thiazol-2-yl)imidazolidin-2-one |
| InChIKey | IDPVLJLFBNPMCT-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)N2CCNC2=O)C(=O)C |
Computed by PubChem (NCBI)