CAS 96356-11-5 is the registry number for Ethyl 2-(2-methylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-(2-methylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)acetate (CAS 96356-11-5) is a chemical compound with the molecular formula C9H11N3O2S and a molecular weight of 225.27 g/mol. IUPAC name: ethyl 2-(2-methylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)acetate. InChIKey: FZYFTXVNJYJCGC-UHFFFAOYSA-N.
| Molecular formula | C9H11N3O2S |
|---|---|
| Molecular weight | 225.27 g/mol |
| IUPAC name | ethyl 2-(2-methylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)acetate |
| InChIKey | FZYFTXVNJYJCGC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=CN2C(=N1)SC(=N2)C |
Computed by PubChem (NCBI)