Methyl 1-(1-phenylethyl)-1H-imidazole-4-carboxylate, 97%
cas: 2650426-58-5 — see every product listed under this CAS number, including other names
Methyl 1-(1-phenylethyl)-1H-imidazole-4-carboxylate, 97% (CAS 2650426-58-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1353243-100mg |
| cas | 2650426-58-5 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 231.31 Pln | |
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 520.56 Pln | |
| Ambeed | 5g | 1710.94 Pln | |
| BLDpharm | 100mg | 214.39 Pln | |
| BLDpharm | 250mg | 297.70 Pln | |
| BLDpharm | 1g | 553.16 Pln | |
| BLDpharm | 5g | 1836.04 Pln | |
| Chemat | 100mg | 218.00 Pln | |
| Chemat | 250mg | 294.80 Pln | |
| Chemat | 1g | 640.40 Pln | |
| Chemat | 5g | 2085.20 Pln | |
| Fluorochem | 100mg | 383.22 Pln | |
| Fluorochem | 250mg | 523.79 Pln | |
| Fluorochem | 1g | 1174.60 Pln | |
| Fluorochem | 5g | 3855.95 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Methyl 1-(1-phenylethyl)imidazole-4-carboxylate (CAS 2650426-58-5) is a chemical compound with the molecular formula C13H14N2O2 and a molecular weight of 230.26 g/mol. IUPAC name: methyl 1-(1-phenylethyl)imidazole-4-carboxylate. InChIKey: HLEIWUQTVWLQIB-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O2 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | methyl 1-(1-phenylethyl)imidazole-4-carboxylate |
| InChIKey | HLEIWUQTVWLQIB-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1)N2C=C(N=C2)C(=O)OC |
Computed by PubChem (NCBI)