cas: 109216-60-6 — see every product listed under this CAS number, including other names
Methyl 1-methyl-1H-indazole-3-carboxylate, 97%, 97% (CAS 109216-60-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg, 500mg, 10g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118TMY-250mg |
| cas | 109216-60-6 |
| size | 250mg |
| availability | 89g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 155.60 Pln | |
| Chemat | 5g | 390.80 Pln | |
| Chemat | 25g | 1432.40 Pln | |
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 500mg | 155.60 Pln | |
| Chemat | 10g | 717.20 Pln | |
| Chemat | 50g | 2728.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 1-methylindazole-3-carboxylate (CAS 109216-60-6) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: methyl 1-methylindazole-3-carboxylate. InChIKey: MTCWFNXKOCOIJV-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | methyl 1-methylindazole-3-carboxylate |
| InChIKey | MTCWFNXKOCOIJV-UHFFFAOYSA-N |
| SMILES | CN1C2=CC=CC=C2C(=N1)C(=O)OC |
Computed by PubChem (NCBI)