cas: 2126160-59-4 — see every product listed under this CAS number, including other names
Methyl 2,3,4,5-tetrahydrobenzo(f)(1,4)oxazepine-5-carboxylate hydrochloride, 98% (CAS 2126160-59-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1434773-1g |
| cas | 2126160-59-4 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 6163.36 Pln | |
| AmBeed | 5g | 13018.39 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl 2,3,4,5-tetrahydro-1,4-benzoxazepine-5-carboxylate;hydrochloride (CAS 2126160-59-4) is a chemical compound with the molecular formula C11H14ClNO3 and a molecular weight of 243.68 g/mol. IUPAC name: methyl 2,3,4,5-tetrahydro-1,4-benzoxazepine-5-carboxylate;hydrochloride. InChIKey: MWMZWEZVQVXQDT-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO3 |
|---|---|
| Molecular weight | 243.68 g/mol |
| IUPAC name | methyl 2,3,4,5-tetrahydro-1,4-benzoxazepine-5-carboxylate;hydrochloride |
| InChIKey | MWMZWEZVQVXQDT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1C2=CC=CC=C2OCCN1.Cl |
Computed by PubChem (NCBI)