cas: 588702-80-1 — see every product listed under this CAS number, including other names
Methyl 2,3-Dihydro-benzofuran-5-carboxylate, 95% (CAS 588702-80-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F033322-1G |
| cas | 588702-80-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 164.54 Pln | |
| Fluorochem | 5g | 341.56 Pln | |
| Fluorochem | 25g | 1471.37 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 2,3-dihydro-1-benzofuran-5-carboxylate (CAS 588702-80-1) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: methyl 2,3-dihydro-1-benzofuran-5-carboxylate. InChIKey: QPGLJPYOFQPEEE-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | methyl 2,3-dihydro-1-benzofuran-5-carboxylate |
| InChIKey | QPGLJPYOFQPEEE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)OCC2 |
Computed by PubChem (NCBI)