cas: 588702-80-1 — see every product listed under this CAS number, including other names
Methyl 2,3-Dihydrobenzofuran-5-carboxylate, >97%, >97% (CAS 588702-80-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114RLK-100mg |
| cas | 588702-80-1 |
| size | 100mg |
| availability | 160.2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 126.80 Pln | |
| Chemat | 5g | 275.60 Pln | |
| Chemat | 25g | 1029.20 Pln | |
| Chemat | 100g | 3515.60 Pln |
| purity | >97% |
|---|---|
| delivery time | 3 weeks |
Methyl 2,3-dihydro-1-benzofuran-5-carboxylate (CAS 588702-80-1) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: methyl 2,3-dihydro-1-benzofuran-5-carboxylate. InChIKey: QPGLJPYOFQPEEE-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | methyl 2,3-dihydro-1-benzofuran-5-carboxylate |
| InChIKey | QPGLJPYOFQPEEE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)OCC2 |
Computed by PubChem (NCBI)