cas: 588702-80-1 — see every product listed under this CAS number, including other names
Methyl 2,3-dihydrobenzofuran-5-carboxylate 98% (CAS 588702-80-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A348844-1g |
| cas | 588702-80-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 353.69 Pln | |
| Ambeed | 25g | 1477.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A348844 |
Methyl 2,3-dihydro-1-benzofuran-5-carboxylate (CAS 588702-80-1) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: methyl 2,3-dihydro-1-benzofuran-5-carboxylate. InChIKey: QPGLJPYOFQPEEE-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | methyl 2,3-dihydro-1-benzofuran-5-carboxylate |
| InChIKey | QPGLJPYOFQPEEE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)OCC2 |
Computed by PubChem (NCBI)