cas: 2504203-50-1 — see every product listed under this CAS number, including other names
Methyl 2,3-difluoro-4-isopropoxybenzoate, 98% (CAS 2504203-50-1) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1656114-10g |
| cas | 2504203-50-1 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 25035.85 Pln | |
| AmBeed | 5g | 14795.62 Pln | |
| AmBeed | 25g | 49155.40 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl 2,3-difluoro-4-propan-2-yloxybenzoate (CAS 2504203-50-1) is a chemical compound with the molecular formula C11H12F2O3 and a molecular weight of 230.21 g/mol. IUPAC name: methyl 2,3-difluoro-4-propan-2-yloxybenzoate. InChIKey: ZDEIJKACQIGWSO-UHFFFAOYSA-N.
| Molecular formula | C11H12F2O3 |
|---|---|
| Molecular weight | 230.21 g/mol |
| IUPAC name | methyl 2,3-difluoro-4-propan-2-yloxybenzoate |
| InChIKey | ZDEIJKACQIGWSO-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C(=C(C=C1)C(=O)OC)F)F |
Computed by PubChem (NCBI)