cas: 544704-78-1 — see every product listed under this CAS number, including other names
Methyl 2,3-difluoro-4-methoxybenzoate, 98% (CAS 544704-78-1) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1655877-10g |
| cas | 544704-78-1 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 8448.37 Pln | |
| AmBeed | 25g | 16572.85 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl 2,3-difluoro-4-methoxybenzoate (CAS 544704-78-1) is a chemical compound with the molecular formula C9H8F2O3 and a molecular weight of 202.15 g/mol. IUPAC name: methyl 2,3-difluoro-4-methoxybenzoate. InChIKey: ZFVVAHZRHQXXGX-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O3 |
|---|---|
| Molecular weight | 202.15 g/mol |
| IUPAC name | methyl 2,3-difluoro-4-methoxybenzoate |
| InChIKey | ZFVVAHZRHQXXGX-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)C(=O)OC)F)F |
Computed by PubChem (NCBI)