cas: 58016-28-7 — see every product listed under this CAS number, including other names
Methyl 2,4-Dihydroxy-6-pentylbenzoate, 98%, 98% (CAS 58016-28-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11JNSD-1g |
| cas | 58016-28-7 |
| size | 1g |
| availability | 780g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 98.00 Pln | |
| Chemat | 10g | 126.80 Pln | |
| Chemat | 25g | 213.20 Pln | |
| Chemat | 50g | 362.00 Pln | |
| Chemat | 100g | 654.80 Pln | |
| Chemat | 250g | 1302.80 Pln | |
| Chemat | 500g | 2198.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 2,4-dihydroxy-6-pentylbenzoate (CAS 58016-28-7) is a chemical compound with the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. IUPAC name: methyl 2,4-dihydroxy-6-pentylbenzoate. InChIKey: RQGAOBDPFOADCM-UHFFFAOYSA-N.
| Molecular formula | C13H18O4 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | methyl 2,4-dihydroxy-6-pentylbenzoate |
| InChIKey | RQGAOBDPFOADCM-UHFFFAOYSA-N |
| SMILES | CCCCCC1=C(C(=CC(=C1)O)O)C(=O)OC |
Computed by PubChem (NCBI)