cas: 58016-28-7 — see every product listed under this CAS number, including other names
Methyl 2,4-dihydroxy-6-pentylbenzoate, 96% (CAS 58016-28-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F545396-5G |
| cas | 58016-28-7 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 133.30 Pln | |
| Fluorochem | 25g | 325.94 Pln | |
| Fluorochem | 100g | 1065.27 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 2,4-dihydroxy-6-pentylbenzoate (CAS 58016-28-7) is a chemical compound with the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. IUPAC name: methyl 2,4-dihydroxy-6-pentylbenzoate. InChIKey: RQGAOBDPFOADCM-UHFFFAOYSA-N.
| Molecular formula | C13H18O4 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | methyl 2,4-dihydroxy-6-pentylbenzoate |
| InChIKey | RQGAOBDPFOADCM-UHFFFAOYSA-N |
| SMILES | CCCCCC1=C(C(=CC(=C1)O)O)C(=O)OC |
Computed by PubChem (NCBI)