cas: 63112-94-7 — see every product listed under this CAS number, including other names
Methyl 2,4-bis(bromomethyl)benzoate, 98% (CAS 63112-94-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F556693-250MG |
| cas | 63112-94-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 299.91 Pln | |
| Fluorochem | 1g | 726.85 Pln | |
| Fluorochem | 5g | 2392.93 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 2,4-bis(bromomethyl)benzoate (CAS 63112-94-7) is a chemical compound with the molecular formula C10H10Br2O2 and a molecular weight of 321.99 g/mol. IUPAC name: methyl 2,4-bis(bromomethyl)benzoate. InChIKey: JXQSETUCFDWTNV-UHFFFAOYSA-N.
| Molecular formula | C10H10Br2O2 |
|---|---|
| Molecular weight | 321.99 g/mol |
| IUPAC name | methyl 2,4-bis(bromomethyl)benzoate |
| InChIKey | JXQSETUCFDWTNV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)CBr)CBr |
Computed by PubChem (NCBI)