cas: 63112-94-7 — see every product listed under this CAS number, including other names
Methyl 2,4-bis(bromomethyl)benzoate, 98% (CAS 63112-94-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F556693-250MG |
| cas | 63112-94-7 |
| size | 250mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 268.67 Pln | |
| Fluorochem | 1g | 461.31 Pln | |
| Fluorochem | 5g | 1648.40 Pln | |
| Ambeed | 250mg | 270.25 Pln | |
| Ambeed | 1g | 448.25 Pln | |
| Ambeed | 5g | 1594.12 Pln | |
| Ambeed | 10g | 3112.69 Pln | |
| Chemat | 250mg | 222.80 Pln | |
| Chemat | 1g | 496.40 Pln | |
| Chemat | 5g | 1691.60 Pln | |
| BLDpharm | 250mg | 286.59 Pln | |
| BLDpharm | 1g | 480.97 Pln | |
| BLDpharm | 5g | 1713.87 Pln | |
| BLDpharm | 10g | 3352.18 Pln |
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
Methyl 2,4-bis(bromomethyl)benzoate (CAS 63112-94-7) is a chemical compound with the molecular formula C10H10Br2O2 and a molecular weight of 321.99 g/mol. IUPAC name: methyl 2,4-bis(bromomethyl)benzoate. InChIKey: JXQSETUCFDWTNV-UHFFFAOYSA-N.
| Molecular formula | C10H10Br2O2 |
|---|---|
| Molecular weight | 321.99 g/mol |
| IUPAC name | methyl 2,4-bis(bromomethyl)benzoate |
| InChIKey | JXQSETUCFDWTNV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)CBr)CBr |
Computed by PubChem (NCBI)