cas: 1538964-46-3 — see every product listed under this CAS number, including other names
Methyl 2,5-dichloro-3-fluorobenzoate 95% (CAS 1538964-46-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A716595-250mg |
| cas | 1538964-46-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 487.19 Pln | |
| Ambeed | 5g | 1666.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A716595 |
Methyl 2,5-dichloro-3-fluorobenzoate (CAS 1538964-46-3) is a chemical compound with the molecular formula C8H5Cl2FO2 and a molecular weight of 223.02 g/mol. IUPAC name: methyl 2,5-dichloro-3-fluorobenzoate. InChIKey: DZWVFPHEKTTWTL-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2FO2 |
|---|---|
| Molecular weight | 223.02 g/mol |
| IUPAC name | methyl 2,5-dichloro-3-fluorobenzoate |
| InChIKey | DZWVFPHEKTTWTL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC(=C1)Cl)F)Cl |
Computed by PubChem (NCBI)