cas: 1538964-46-3 — see every product listed under this CAS number, including other names
Methyl 2,5-dichloro-3-fluorobenzoate, ≥95%, ≥95% (CAS 1538964-46-3) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch132Q4X-1g |
| cas | 1538964-46-3 |
| size | 1g |
| availability | 99g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 798.80 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
Methyl 2,5-dichloro-3-fluorobenzoate (CAS 1538964-46-3) is a chemical compound with the molecular formula C8H5Cl2FO2 and a molecular weight of 223.02 g/mol. IUPAC name: methyl 2,5-dichloro-3-fluorobenzoate. InChIKey: DZWVFPHEKTTWTL-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2FO2 |
|---|---|
| Molecular weight | 223.02 g/mol |
| IUPAC name | methyl 2,5-dichloro-3-fluorobenzoate |
| InChIKey | DZWVFPHEKTTWTL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC(=C1)Cl)F)Cl |
Computed by PubChem (NCBI)