CAS 203573-10-8 appears in our catalog under these names: Methyl 2,5-dichloro-4-methylbenzoate, 98%, 98%, METHYL 2,5-DICHLORO-4-METHYLBENZOATE, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g.
Methyl 2,5-dichloro-4-methylbenzoate (CAS 203573-10-8) is a chemical compound with the molecular formula C9H8Cl2O2 and a molecular weight of 219.06 g/mol. IUPAC name: methyl 2,5-dichloro-4-methylbenzoate. InChIKey: GLGKDOSRCSEFNQ-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O2 |
|---|---|
| Molecular weight | 219.06 g/mol |
| IUPAC name | methyl 2,5-dichloro-4-methylbenzoate |
| InChIKey | GLGKDOSRCSEFNQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Cl)C(=O)OC)Cl |
Computed by PubChem (NCBI)