Methyl 2-(2-bromo-3-methylphenyl)acetate, 95%
cas: 512786-36-6 — see every product listed under this CAS number, including other names
Methyl 2-(2-bromo-3-methylphenyl)acetate, 95% (CAS 512786-36-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A995025-100mg |
| cas | 512786-36-6 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 231.31 Pln | |
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 743.06 Pln | |
| Ambeed | 5g | 2756.69 Pln | |
| Chemat | 100mg | 232.40 Pln | |
| Chemat | 250mg | 333.20 Pln | |
| Chemat | 1g | 765.20 Pln | |
| Chemat | 5g | 2872.40 Pln | |
| BLDpharm | 100mg | 242.16 Pln | |
| BLDpharm | 250mg | 347.68 Pln | |
| BLDpharm | 1g | 791.97 Pln | |
| BLDpharm | 5g | 2968.98 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Methyl 2-(2-bromo-3-methylphenyl)acetate (CAS 512786-36-6) is a chemical compound with the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. IUPAC name: methyl 2-(2-bromo-3-methylphenyl)acetate. InChIKey: CTUNQEFZKJXZQU-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO2 |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | methyl 2-(2-bromo-3-methylphenyl)acetate |
| InChIKey | CTUNQEFZKJXZQU-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)CC(=O)OC)Br |
Computed by PubChem (NCBI)