CAS 512786-36-6 is the registry number for Methyl 2-(2-bromo-3-methylphenyl)acetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Methyl 2-(2-bromo-3-methylphenyl)acetate (CAS 512786-36-6) is a chemical compound with the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. IUPAC name: methyl 2-(2-bromo-3-methylphenyl)acetate. InChIKey: CTUNQEFZKJXZQU-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO2 |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | methyl 2-(2-bromo-3-methylphenyl)acetate |
| InChIKey | CTUNQEFZKJXZQU-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)CC(=O)OC)Br |
Computed by PubChem (NCBI)