cas: 112918-77-1 — see every product listed under this CAS number, including other names
Methyl 2-(4-((tert-butoxycarbonyl)amino)phenyl)acetate 97% (CAS 112918-77-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A618885-1g |
| cas | 112918-77-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 642.94 Pln | |
| Ambeed | 25g | 1638.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A618885 |
Methyl 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]acetate (CAS 112918-77-1) is a chemical compound with the molecular formula C14H19NO4 and a molecular weight of 265.30 g/mol. IUPAC name: methyl 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]acetate. InChIKey: SWVCXLXHFUCMFW-UHFFFAOYSA-N.
| Molecular formula | C14H19NO4 |
|---|---|
| Molecular weight | 265.30 g/mol |
| IUPAC name | methyl 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]acetate |
| InChIKey | SWVCXLXHFUCMFW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC=C(C=C1)CC(=O)OC |
Computed by PubChem (NCBI)