cas: 83636-46-8 — see every product listed under this CAS number, including other names
Methyl 2-(4-bromophenyl)propanoate 97% (CAS 83636-46-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A205565-100mg |
| cas | 83636-46-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 448.25 Pln | |
| Ambeed | 250mg | 565.06 Pln | |
| Ambeed | 1g | 1327.12 Pln | |
| Ambeed | 5g | 3841.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A205565 |
Methyl 2-(4-bromophenyl)propanoate (CAS 83636-46-8) is a chemical compound with the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. IUPAC name: methyl 2-(4-bromophenyl)propanoate. InChIKey: KZWKRXZFJWFHSR-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO2 |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | methyl 2-(4-bromophenyl)propanoate |
| InChIKey | KZWKRXZFJWFHSR-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)Br)C(=O)OC |
Computed by PubChem (NCBI)