Methyl 2-(4-cyanophenyl)-2-oxoacetate, 95%
cas: 52798-47-7 — see every product listed under this CAS number, including other names
Methyl 2-(4-cyanophenyl)-2-oxoacetate, 95% (CAS 52798-47-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A421196-100mg |
| cas | 52798-47-7 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 481.62 Pln | |
| Ambeed | 250mg | 765.31 Pln | |
| Ambeed | 1g | 2028.00 Pln | |
| Ambeed | 5g | 3913.69 Pln | |
| Chemat | 100mg | 328.40 Pln | |
| Chemat | 250mg | 506.00 Pln | |
| Chemat | 1g | 1125.20 Pln | |
| Chemat | 5g | 2723.60 Pln | |
| BLDpharm | 100mg | 514.29 Pln | |
| BLDpharm | 250mg | 819.74 Pln | |
| BLDpharm | 1g | 2180.37 Pln | |
| BLDpharm | 5g | 4212.99 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Methyl 2-(4-cyanophenyl)-2-oxoacetate (CAS 52798-47-7) is a chemical compound with the molecular formula C10H7NO3 and a molecular weight of 189.17 g/mol. IUPAC name: methyl 2-(4-cyanophenyl)-2-oxoacetate. InChIKey: XVQCCRZZQODRJH-UHFFFAOYSA-N.
| Molecular formula | C10H7NO3 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | methyl 2-(4-cyanophenyl)-2-oxoacetate |
| InChIKey | XVQCCRZZQODRJH-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)C1=CC=C(C=C1)C#N |
Computed by PubChem (NCBI)