CAS 14441-90-8 appears in our catalog under these names: 5-Phenylisoxazole-3-carboxylic acid, 98%, 5-Phenylisoxazole-3-carboxylic acid, 5-Phenylisoxazole-3-carboxylic Acid, >98.0%(HPLC)(T), 5-Phenylisoxazole-3-carboxylic acid 97%, 5-PHENYLISOXAZOLE-3-CARBOXYLIC ACID, 97%. Offered by: Combi-blocks, Biosynth, TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 10g, 100g, 5g, 25g, 1g, 100mg, 250mg.
5-phenyl-1,2-oxazole-3-carboxylic acid (CAS 14441-90-8) is a chemical compound with the molecular formula C10H7NO3 and a molecular weight of 189.17 g/mol. IUPAC name: 5-phenyl-1,2-oxazole-3-carboxylic acid. InChIKey: XJYOBHXWBRKOQO-UHFFFAOYSA-N.
| Molecular formula | C10H7NO3 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 5-phenyl-1,2-oxazole-3-carboxylic acid |
| InChIKey | XJYOBHXWBRKOQO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NO2)C(=O)O |
Computed by PubChem (NCBI)