cas: 70129-95-2 — see every product listed under this CAS number, including other names
Methyl 2-(4-formylphenoxy)propanoate, 97% (CAS 70129-95-2) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F775530-500MG |
| cas | 70129-95-2 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 1028.82 Pln | |
| Fluorochem | 1g | 1539.06 Pln | |
| Fluorochem | 5g | 4475.53 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 2-(4-formylphenoxy)propanoate (CAS 70129-95-2) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. IUPAC name: methyl 2-(4-formylphenoxy)propanoate. InChIKey: XMSBEICDSVTRGX-UHFFFAOYSA-N.
| Molecular formula | C11H12O4 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | methyl 2-(4-formylphenoxy)propanoate |
| InChIKey | XMSBEICDSVTRGX-UHFFFAOYSA-N |
| SMILES | CC(C(=O)OC)OC1=CC=C(C=C1)C=O |
Computed by PubChem (NCBI)