cas: 50415-69-5 — see every product listed under this CAS number, including other names
Methyl 2-(4-nitrophenyl)propanoate, 98%, 98% (CAS 50415-69-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DD15-250mg |
| cas | 50415-69-5 |
| size | 250mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 362.00 Pln | |
| Chemat | 25g | 1149.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-(4-nitrophenyl)propanoate (CAS 50415-69-5) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. IUPAC name: methyl 2-(4-nitrophenyl)propanoate. InChIKey: NWHFCRJVWNLNHP-UHFFFAOYSA-N.
| Molecular formula | C10H11NO4 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | methyl 2-(4-nitrophenyl)propanoate |
| InChIKey | NWHFCRJVWNLNHP-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)