Methyl 2-(chlorosulfonyl)-4-fluorobenzoate, 95%
cas: 1156254-63-5 — see every product listed under this CAS number, including other names
Methyl 2-(chlorosulfonyl)-4-fluorobenzoate, 95% (CAS 1156254-63-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1117541-250mg |
| cas | 1156254-63-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 309.19 Pln | |
| Ambeed | 1g | 715.25 Pln | |
| Ambeed | 5g | 2306.13 Pln | |
| Chemat | 100mg | 160.40 Pln | |
| Chemat | 250mg | 227.60 Pln | |
| Chemat | 1g | 501.20 Pln | |
| Chemat | 5g | 1600.40 Pln | |
| BLDpharm | 100mg | 208.84 Pln | |
| BLDpharm | 250mg | 303.25 Pln | |
| BLDpharm | 1g | 703.11 Pln | |
| BLDpharm | 5g | 2269.23 Pln | |
| Fluorochem | 100mg | 268.67 Pln | |
| Fluorochem | 250mg | 398.84 Pln | |
| Fluorochem | 1g | 919.49 Pln | |
| Fluorochem | 5g | 2981.26 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Methyl 2-chlorosulfonyl-4-fluorobenzoate (CAS 1156254-63-5) is a chemical compound with the molecular formula C8H6ClFO4S and a molecular weight of 252.65 g/mol. IUPAC name: methyl 2-chlorosulfonyl-4-fluorobenzoate. InChIKey: TUNCTHJWHJYMPD-UHFFFAOYSA-N.
| Molecular formula | C8H6ClFO4S |
|---|---|
| Molecular weight | 252.65 g/mol |
| IUPAC name | methyl 2-chlorosulfonyl-4-fluorobenzoate |
| InChIKey | TUNCTHJWHJYMPD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)