cas: 1160490-11-8 — see every product listed under this CAS number, including other names
Methyl 2-(methylthio)benzo[d]oxazole-6-carboxylate 98% (CAS 1160490-11-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A595673-100mg |
| cas | 1160490-11-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 186.81 Pln | |
| Ambeed | 250mg | 220.19 Pln | |
| Ambeed | 1g | 437.12 Pln | |
| Ambeed | 5g | 1894.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A595673 |
Methyl 2-methylsulfanyl-1,3-benzoxazole-6-carboxylate (CAS 1160490-11-8) is a chemical compound with the molecular formula C10H9NO3S and a molecular weight of 223.25 g/mol. IUPAC name: methyl 2-methylsulfanyl-1,3-benzoxazole-6-carboxylate. InChIKey: BDKGTQWURKNUJN-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3S |
|---|---|
| Molecular weight | 223.25 g/mol |
| IUPAC name | methyl 2-methylsulfanyl-1,3-benzoxazole-6-carboxylate |
| InChIKey | BDKGTQWURKNUJN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)N=C(O2)SC |
Computed by PubChem (NCBI)