cas: 1160490-11-8 — see every product listed under this CAS number, including other names
Methyl 2-(methylthio)benzo[d]oxazole-6-carboxylate, 98% (CAS 1160490-11-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F244487-100MG |
| cas | 1160490-11-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 102.07 Pln | |
| Fluorochem | 250mg | 112.48 Pln | |
| Fluorochem | 1g | 216.61 Pln | |
| Fluorochem | 5g | 820.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Methyl 2-methylsulfanyl-1,3-benzoxazole-6-carboxylate (CAS 1160490-11-8) is a chemical compound with the molecular formula C10H9NO3S and a molecular weight of 223.25 g/mol. IUPAC name: methyl 2-methylsulfanyl-1,3-benzoxazole-6-carboxylate. InChIKey: BDKGTQWURKNUJN-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3S |
|---|---|
| Molecular weight | 223.25 g/mol |
| IUPAC name | methyl 2-methylsulfanyl-1,3-benzoxazole-6-carboxylate |
| InChIKey | BDKGTQWURKNUJN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)N=C(O2)SC |
Computed by PubChem (NCBI)