cas: 1160490-11-8 — see every product listed under this CAS number, including other names
Methyl 2-(methylthio)benzo[d]oxazole-6-carboxylate, 98%, 98% (CAS 1160490-11-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111BH1-5g |
| cas | 1160490-11-8 |
| size | 5g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 1662.80 Pln | |
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 141.20 Pln | |
| Chemat | 1g | 381.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-methylsulfanyl-1,3-benzoxazole-6-carboxylate (CAS 1160490-11-8) is a chemical compound with the molecular formula C10H9NO3S and a molecular weight of 223.25 g/mol. IUPAC name: methyl 2-methylsulfanyl-1,3-benzoxazole-6-carboxylate. InChIKey: BDKGTQWURKNUJN-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3S |
|---|---|
| Molecular weight | 223.25 g/mol |
| IUPAC name | methyl 2-methylsulfanyl-1,3-benzoxazole-6-carboxylate |
| InChIKey | BDKGTQWURKNUJN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)N=C(O2)SC |
Computed by PubChem (NCBI)