cas: 138825-96-4 — see every product listed under this CAS number, including other names
Methyl 2-acetamido-5-bromobenzoate, 95% (CAS 138825-96-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F635421-1G |
| cas | 138825-96-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 174.96 Pln | |
| Fluorochem | 25g | 325.94 Pln | |
| Fluorochem | 100g | 945.52 Pln | |
| Fluorochem | 500g | 4074.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 2-acetamido-5-bromobenzoate (CAS 138825-96-4) is a chemical compound with the molecular formula C10H10BrNO3 and a molecular weight of 272.09 g/mol. IUPAC name: methyl 2-acetamido-5-bromobenzoate. InChIKey: CPARHIBNDSEJGR-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO3 |
|---|---|
| Molecular weight | 272.09 g/mol |
| IUPAC name | methyl 2-acetamido-5-bromobenzoate |
| InChIKey | CPARHIBNDSEJGR-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=C(C=C1)Br)C(=O)OC |
Computed by PubChem (NCBI)