CAS 1186311-21-6 is the registry number for 6-Bromo-2-(dimethoxymethyl)furo[3,2-b]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-bromo-2-(dimethoxymethyl)furo[3,2-b]pyridine (CAS 1186311-21-6) is a chemical compound with the molecular formula C10H10BrNO3 and a molecular weight of 272.09 g/mol. IUPAC name: 6-bromo-2-(dimethoxymethyl)furo[3,2-b]pyridine. InChIKey: RYFJQGIXXKWTRM-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO3 |
|---|---|
| Molecular weight | 272.09 g/mol |
| IUPAC name | 6-bromo-2-(dimethoxymethyl)furo[3,2-b]pyridine |
| InChIKey | RYFJQGIXXKWTRM-UHFFFAOYSA-N |
| SMILES | COC(C1=CC2=C(O1)C=C(C=N2)Br)OC |
Computed by PubChem (NCBI)