CAS 1252686-47-7 appears in our catalog under these names: (5R)-3-(4-Bromophenyl)-5-(hydroxymethyl)-1,3-oxazolidin-2-one, 95%, Tedizolid Impurity 64. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 250mg, 1g, on request.
(5R)-3-(4-bromophenyl)-5-(hydroxymethyl)-1,3-oxazolidin-2-one (CAS 1252686-47-7) is a chemical compound with the molecular formula C10H10BrNO3 and a molecular weight of 272.09 g/mol. IUPAC name: (5R)-3-(4-bromophenyl)-5-(hydroxymethyl)-1,3-oxazolidin-2-one. InChIKey: YVHKIBHMVGVOTH-SECBINFHSA-N.
| Molecular formula | C10H10BrNO3 |
|---|---|
| Molecular weight | 272.09 g/mol |
| IUPAC name | (5R)-3-(4-bromophenyl)-5-(hydroxymethyl)-1,3-oxazolidin-2-one |
| InChIKey | YVHKIBHMVGVOTH-SECBINFHSA-N |
| SMILES | C1[C@@H](OC(=O)N1C2=CC=C(C=C2)Br)CO |
Computed by PubChem (NCBI)