Products 2140305-33-3
CAS 2140305-33-3 is the registry number for Ethyl 3-(4-bromopyridin-2-yl)-2-oxopropanoate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 25g.
Ethyl 3-(4-bromo-2-pyridinyl)-2-oxopropanoate (CAS 2140305-33-3) is a chemical compound with the molecular formula C10H10BrNO3 and a molecular weight of 272.09 g/mol. IUPAC name: ethyl 3-(4-bromo-2-pyridinyl)-2-oxopropanoate. InChIKey: HAKXFZMKEKZFMA-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO3 |
|---|---|
| Molecular weight | 272.09 g/mol |
| IUPAC name | ethyl 3-(4-bromo-2-pyridinyl)-2-oxopropanoate |
| InChIKey | HAKXFZMKEKZFMA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)CC1=NC=CC(=C1)Br |
Computed by PubChem (NCBI)