Products 883107-60-6
CAS 883107-60-6 appears in our catalog under these names: Ethyl 3-(5-bromopyridin-3-yl)-3-oxopropanoate, 95%, ethyl 3-(5-bromopyridin-3-yl)-3-oxopropanoate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 5g, 0,5g.
Ethyl 3-(5-bromo-3-pyridinyl)-3-oxopropanoate (CAS 883107-60-6) is a chemical compound with the molecular formula C10H10BrNO3 and a molecular weight of 272.09 g/mol. IUPAC name: ethyl 3-(5-bromo-3-pyridinyl)-3-oxopropanoate. InChIKey: IXNOPBDYHDTNDI-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO3 |
|---|---|
| Molecular weight | 272.09 g/mol |
| IUPAC name | ethyl 3-(5-bromo-3-pyridinyl)-3-oxopropanoate |
| InChIKey | IXNOPBDYHDTNDI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)C1=CC(=CN=C1)Br |
Computed by PubChem (NCBI)