cas: 1183581-39-6 — see every product listed under this CAS number, including other names
Methyl 2-amino-2-(3-bromophenyl)propanoate 95+% (CAS 1183581-39-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A606369-50mg |
| cas | 1183581-39-6 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 387.06 Pln | |
| Ambeed | 100mg | 548.38 Pln | |
| Ambeed | 250mg | 1176.94 Pln | |
| Ambeed | 1g | 3057.06 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A606369 |
Methyl 2-amino-2-(3-bromophenyl)propanoate (CAS 1183581-39-6) is a chemical compound with the molecular formula C10H12BrNO2 and a molecular weight of 258.11 g/mol. IUPAC name: methyl 2-amino-2-(3-bromophenyl)propanoate. InChIKey: SBLKKJBRKIWUQH-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO2 |
|---|---|
| Molecular weight | 258.11 g/mol |
| IUPAC name | methyl 2-amino-2-(3-bromophenyl)propanoate |
| InChIKey | SBLKKJBRKIWUQH-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=CC=C1)Br)(C(=O)OC)N |
Computed by PubChem (NCBI)