cas: 183562-37-0 — see every product listed under this CAS number, including other names
Methyl 2-amino-4-isobutylthiophene-3-carboxylate, 95% (CAS 183562-37-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 2.5g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F763569-100MG |
| cas | 183562-37-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 331.15 Pln | |
| Fluorochem | 250mg | 502.97 Pln | |
| Fluorochem | 500mg | 893.45 Pln | |
| Fluorochem | 1g | 1138.16 Pln | |
| Fluorochem | 2.5g | 2700.11 Pln | |
| Fluorochem | 5g | 3606.04 Pln | |
| Fluorochem | 10g | 5850.04 Pln | |
| Fluorochem | 25g | 12795.51 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 2-amino-4-(2-methylpropyl)thiophene-3-carboxylate (CAS 183562-37-0) is a chemical compound with the molecular formula C10H15NO2S and a molecular weight of 213.30 g/mol. IUPAC name: methyl 2-amino-4-(2-methylpropyl)thiophene-3-carboxylate. InChIKey: XVYAEAXXDWJBDM-UHFFFAOYSA-N.
| Molecular formula | C10H15NO2S |
|---|---|
| Molecular weight | 213.30 g/mol |
| IUPAC name | methyl 2-amino-4-(2-methylpropyl)thiophene-3-carboxylate |
| InChIKey | XVYAEAXXDWJBDM-UHFFFAOYSA-N |
| SMILES | CC(C)CC1=CSC(=C1C(=O)OC)N |
Computed by PubChem (NCBI)