cas: 183562-37-0 — see every product listed under this CAS number, including other names
methyl 2-amino-4-(2-methylpropyl)thiophene-3-carboxylate, 95%, 95% (CAS 183562-37-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I2F0-250mg |
| cas | 183562-37-0 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 414.80 Pln | |
| Chemat | 1g | 1043.60 Pln | |
| Chemat | 5g | 2910.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-amino-4-(2-methylpropyl)thiophene-3-carboxylate (CAS 183562-37-0) is a chemical compound with the molecular formula C10H15NO2S and a molecular weight of 213.30 g/mol. IUPAC name: methyl 2-amino-4-(2-methylpropyl)thiophene-3-carboxylate. InChIKey: XVYAEAXXDWJBDM-UHFFFAOYSA-N.
| Molecular formula | C10H15NO2S |
|---|---|
| Molecular weight | 213.30 g/mol |
| IUPAC name | methyl 2-amino-4-(2-methylpropyl)thiophene-3-carboxylate |
| InChIKey | XVYAEAXXDWJBDM-UHFFFAOYSA-N |
| SMILES | CC(C)CC1=CSC(=C1C(=O)OC)N |
Computed by PubChem (NCBI)