cas: 1464091-62-0 — see every product listed under this CAS number, including other names
Methyl 2-amino-5-iodo-4-methylbenzoate 95% (CAS 1464091-62-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A834607-100mg |
| cas | 1464091-62-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 275.81 Pln | |
| Ambeed | 250mg | 314.75 Pln | |
| Ambeed | 1g | 854.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A834607 |
Methyl 2-amino-5-iodo-4-methylbenzoate (CAS 1464091-62-0) is a chemical compound with the molecular formula C9H10INO2 and a molecular weight of 291.09 g/mol. IUPAC name: methyl 2-amino-5-iodo-4-methylbenzoate. InChIKey: NFCJVRIKQOSUBJ-UHFFFAOYSA-N.
| Molecular formula | C9H10INO2 |
|---|---|
| Molecular weight | 291.09 g/mol |
| IUPAC name | methyl 2-amino-5-iodo-4-methylbenzoate |
| InChIKey | NFCJVRIKQOSUBJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1I)C(=O)OC)N |
Computed by PubChem (NCBI)